மீத்தோடிரெக்சேட்டு

கட்டற்ற கலைக்களஞ்சியமான விக்கிப்பீடியாவில் இருந்து.
Jump to navigation Jump to search

{{Drugbox | verifiedrevid = 464193974 | IUPAC_name = (2S)-2-[(4-{[(2,4-டைஅமினோப்டெரின்-6-யில்)மீதைல்](மீதைல்)அமினோ}பென்சாயில்)அமினோ] பென்டேன்டையோயிக் அமிலம் | image = Methotrexate skeletal.svg | width = 180 | image2 = Methotrexate-3D-balls-1U72.png | width2 = 180

| tradename = டிரெக்சால் | Drugs.com = | MedlinePlus = a682019 | pregnancy_AU = | pregnancy_US = | legal_AU = | legal_UK = | legal_US = | routes_of_administration = வாய்வழி, சிரைவழி, தசைவழி, தோலுக்கடியில், தண்டுவட உறைவழி

| bioavailability = 17–90% | metabolism = கல்லீரல்வழி | elimination_half-life = 15 மணிநேரம் (மருந்தளவைப் பொறுத்து) | excretion = சிறுநீரகவழி; 48–100%

| CASNo_Ref =  Yes check.svgY | CAS_number_Ref =  Yes check.svgY | CAS_number = 59-05-2 | ATC_prefix = L01 | ATC_suffix = BA01 | ATC_supplemental = L04AX03 | PubChem = 126941 | DrugBank_Ref =  Yes check.svgY | DrugBank = DB00563 | ChemSpiderID_Ref =  Yes check.svgY | ChemSpiderID = 112728 | UNII_Ref =  Yes check.svgY | UNII = YL5FZ2Y5U1 | KEGG_Ref =  Yes check.svgY | KEGG = D00142 | ChEBI_Ref =  Yes check.svgY | ChEBI = 44185 | ChEMBL_Ref =  Yes check.svgY | ChEMBL = 34259

| C=20 | H=22 | N=8 | O=5 | molecular_weight = 454.44 கி/மோல் | smiles = O=C(O)[C@@H](NC(=O)c1ccc(cc1)N(C)Cc2nc3c(nc2)nc(nc3N)N)CCC(=O)O | InChI = 1/C20H22N8O5/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30/h2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27)/t13-/m0/s1 | StdInChI_Ref =  Yes check.svgY | StdInChI = 1S/C20H22N8O5/c1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30/h2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27)/t13-/m0/s1 | StdInChIKey_Ref =  Yes check.svgY | StdInChIKey = FBOZXECLQNJBKD-ZDUSSCGKSA-N }} மீத்தோடிரெக்சேட்டு (Methotrexate) [குறுக்கம்: MTX; பழைய பெயர்: அமிதோப்டெரின் (amethopterin)], வளர்சிதைமாற்றத் தடுப்பியும், ஃபோலிக் அமிலத்தடுப்பி மருந்துமாகும். இது புற்றுநோய், தன்னெதிர்ப்பு நோய்கள், கருக்குழாய் கருவளர்ச்சி (ectopic pregnancy), மருத்துவ கருக்கலைப்பு ஆகியவற்றில் சிகிச்சைக்காக உபயோகப்படுத்தப்படுகிறது[1]. 1950 - ஆம் ஆண்டுகளிலிருந்து மிகவும் நஞ்சார்ந்த ஃபோலிக் அமிலத்தடுப்பியான அமினோப்டெரின் மருந்திற்கு பதிலாக மீத்தோடிரெக்சேட்டு பயன்படுத்தப்படுகிறது. மீத்தோடிரெக்சேட்டு, ஃபோலிக் அமில வளர்சிதைமாற்றத்தைத் தடுப்பதன் மூலம் செயல்படுகிறது. இம்மருந்து இந்திய உயிர்வேதியியலாளரான சுப்பாராவ் என்பவரால் அமெரிக்காவில் உருவாக்கப்பட்டது[2][3][4].

மேற்கோள்கள்[தொகு]

  1. "Methotrexate". The American Society of Health-System Pharmacists. பார்த்த நாள் 3 April 2011.
  2. Farber et al.'s article, published in the New England Journal of Medicine in 1946, noted Dr Subbarao's work as a foundation for this landmark paper. The paper remains one of the earliest top-cited research articles and is a classic in the field of medicine.
  3. "Temporary remissions in acute leukemia in children produced by folic acid antagonist, 4-aminopteroyl-glutamic acid (aminopterin)". N. Engl. J. Med. 238 (23): 787–93. 1948. doi:10.1056/NEJM194806032382301. பப்மெட்:18860765. 
  4. Miller, DR (2006). "A tribute to Sidney Farber-- the father of modern chemotherapy". British journal of haematology 134 (1): 20–6. doi:10.1111/j.1365-2141.2006.06119.x. பப்மெட்:16803563. 

வெளியிணைப்புகள்[தொகு]

"https://ta.wikipedia.org/w/index.php?title=மீத்தோடிரெக்சேட்டு&oldid=1728819" இருந்து மீள்விக்கப்பட்டது