உயிர்ச்சத்து ஈ

கட்டற்ற கலைக்களஞ்சியமான விக்கிப்பீடியாவில் இருந்து.
(டொக்கோப்ஃபரோல் இலிருந்து வழிமாற்றப்பட்டது)
Jump to navigation Jump to search
α-Tocopherol [1]
α-Tocopherol
வேதியல் பெயர் (2R)-2,5,7,8-Tetramethyl-2-[(4R,8R)-4,8,12
-trimethyltridecyl]-3,4-dihydro-2H-chromen-6-ol
வேதியல் சமன்பாடு C29H50O2
மூலக்கூற்றுத் திணிவு 430.69 g/mol
CAS எண் [59-02-9]
அடர்த்தி 0.950 g/cm³
உருகுநிலை 2.5-3.5 °C
கொதிநிலை 200-220 °C at 0.1 mmHg
SMILES CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC
[C@]1(C)CCc2c(C)c(O)c(C)c(C)c2O1

உயிர்ச்சத்து E உடலில் நோய் எதிர்ப்பு சக்தியை பெருக்கக்கூடியது. கண்புரை ஏற்படுவதைத் தவிர்க்கும். அல்ஜைமர்ஸ் எனும் நினைவு இழப்பு நோயின் முன்னேற்ற வேகத்தைக் குறைக்கும். இதைத்தவிர இரத்தக்குழாய்களில் இரத்தம் உறைவதைத் தடுக்கும். பாஸ்டனைச் சேர்ந்த ஆராய்ச்சியாளர் ஜெப்ரி ப்ளும்பெர்க் என்பவர் ஒரு நாளைக்கு 100 முதல் 400 IU அளவு இந்த உயிர்ச்சத்தை பெறுவது உடலுக்கு நன்மை பயக்கும் என்று தெரிவிக்கிறார். அபாய அளவு தாண்டி உட்கொண்டால் மூளையிலுள்ள குருதி நாளங்களில் குருதிக் கசிவு ஏற்பட வாய்ப்புண்டு. மேலும் இரத்தத்தை உறைய விடாமல் தடுப்பதால் காயம் பட்டால் சிரமமும் ஏற்படும்.

ஆதாரம்[தொகு]

  1. Merck Index, 11th Edition, 9931.


உயிர்ச்சத்துக்கள்
அனைத்து B உயிர்ச்சத்துக்கள் | அனைத்து D உயிர்ச்சத்துக்கள்
ரெட்டினால் (A) | தயமின் (B1) | இரைபோஃபிளவின் (B2) | நியாசின் (B3) | பன்டோதீனிக் அமிலம் (B5) | பிரிடொக்சின் (B6) | பயோட்டின் (B7) | போலிக் அமிலம் (B9) | கோபாலமின் (B12) | அசுக்கோபிக் அமிலம் (C) | எர்கோகல்சிப்ஃபரோல் (D2) | கல்சிப்ஃபரோல் (D3) | டொக்கோப்ஃபரோல் (E) | நப்ஃதோகுயினோன் (K)
"https://ta.wikipedia.org/w/index.php?title=உயிர்ச்சத்து_ஈ&oldid=1341667" இருந்து மீள்விக்கப்பட்டது