உள்ளடக்கத்துக்குச் செல்

அமோனியம் அயோடேட்டு

கட்டற்ற கலைக்களஞ்சியமான விக்கிப்பீடியாவில் இருந்து.
அமோனியம் அயோடேட்டு
Ammonium cation
Ammonium cation
Iodate anion
பெயர்கள்
ஐயூபிஏசி பெயர்
அமோனியம் அயோடேட்டு
வேறு பெயர்கள்
அயோடிக் அமிலம், அமோனியம் உப்பு
இனங்காட்டிகள்
13446-09-8
ChemSpider 145937
InChI
  • InChI=1S/HIO3.H3N/c2-1(3)4;/h(H,2,3,4);1H3
    Key: ZRDJERPXCFOFCP-UHFFFAOYSA-N
யேமல் -3D படிமங்கள் Image
பப்கெம் 166805
  • [NH4+].[O-]I(=O)=O
பண்புகள்
NH4IO3
வாய்ப்பாட்டு எடை 192.94 கிராம்/மோல்
தோற்றம் வெண்மையான படிகத் தூள்
அடர்த்தி 3.309 கிராம்/செ.மீ3
உருகுநிலை 150°செல்சியசில் சிதைவடையும்
29.883 கிராம்/லிட்டர் (25°செல்சியசில்) [1]
-62.3•10−6 செ.மீ3/மோல்
மாறுதலாக ஏதும் சொல்லவில்லை என்றால் கொடுக்கப்பட்ட தரவுகள் யாவும்
பொருள்கள் அவைகளின் இயல்பான வெப்ப அழுத்த நிலையில் (25°C, 100kPa) இருக்கும்.

அமோனியம் அயோடேட்டு (Ammonium iodate) என்பது NH4IO3 என்ற வாய்ப்பாட்டைக் கொண்ட கனிம வேதியியல் சேர்மம் ஆகும். எல்லா அயோடேட்டு உப்புகளைப் போலவே அமோனியம் அயோடேட்டும் குளிர்ந்த நீரில் மிகக் குறைவாகவும் சூடான நீரில் மிதமாகவும் கரைகிறது. இது ஒரு வலிமையான ஆக்சிசனேற்றியாகும்.

தயாரிப்பு[தொகு]

அமோனியாவுடன் அயோடிக் அமிலத்தைச் சேர்த்து நடுநிலையாக்கம் செய்வதன் மூலம் அமோனியம் அயோடேட்டைத் தயாரிக்க முடியும் [2]

HIO3 + NH3 → NH4IO3.

தண்ணீரில் மிகக் குறைவாக கரையும் பண்பைக் கொண்டு ஓர் அமோனியம் உப்புடன் அயோடேட்டு கரைசலைச் சேர்த்து இதை வீழ்படிவாக்கியும் தயாரிக்கலாம்.

2 KIO3 + (NH4)2SO4 → 2 NH4IO3 + K2SO4

அயோடினை அமோனியம் ஐதராக்சைடு கரைசலில் கரைத்து பிற அயோடேட்டுகள் தயாரிப்பது போல அமோனியம் அயோடேட்டைத் தயாரிக்க இயலாது. இவ்வினையில் வெடிபொருளான நைட்ரசன் டிரை அயோடைடு உருவாகிறது.

3 I2 + 5 NH3 → 3 NH4I + NH3*NI3

வேதிப்பண்புகள்[தொகு]

ஒடுக்கும் அமோனியம் அயனியும் ஆக்சிசனேற்றும் அயோடேட்டு அயனியும் அமோனியம் அயோடேட்டில் இருப்பதால் 150° செல்சியசு வெப்பநிலையில் இது நைட்ரசன், ஆக்சிசன், அயோடின் மற்றும் தண்ணீராக சிதைவடைகிறது. 60 °செல்சியசு வெப்பநிலைக்கு கீழான வெப்பநிலையில் இவ்வினை நிகழ்வதில்லை. ஆனால் பொட்டாசியம் டைகுரோமேட்டு அல்லது தாமிர(II) குளோரைடு வினையூக்கியின் இதுவும் அறை வெப்பநிலையில் எரிகிறது[2].

NH4IO3N2 + O2 + I2 + H2O

பாதுகாப்பு[தொகு]

அனைத்து அயோடேட்டு உப்புகளைப் போல அமோனியம் அயோடேட்டும் ஒரு வலிமையான ஆக்சிசனேற்ரியாகச் செயல்படும் என்பதால் இதை கந்தகம், பாசுபரசு மற்றும் உலோகத் தூள்கள் போன்ற தீப்பற்றும் பொருட்களிடம் இருந்து தொலைவில் வைக்கப்படவேண்டும்[3].

மேற்கோள்கள்[தொகு]

  1. "Eigenschaften von Ammoniumiodat - Das Periodensystem online".
  2. 2.0 2.1 "காப்பகப்படுத்தப்பட்ட நகல்" (PDF). Archived from the original (PDF) on 2016-10-28. பார்க்கப்பட்ட நாள் 2018-06-25.
  3. https://www.alfa.com/de/content/msds/english/14531.pdf
"https://ta.wikipedia.org/w/index.php?title=அமோனியம்_அயோடேட்டு&oldid=3541346" இலிருந்து மீள்விக்கப்பட்டது